C23H34N6O3 — CID 16661074
4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-N-(2-ethoxyethyl)-6-methylquinazoline-2-carboxamide (PubChem CID 16661074) has the molecular formula C23H34N6O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-N-(2-ethoxyethyl)-6-methylquinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-N-(2-ethoxyethyl)-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 16661074 |
| Molecular Formula | C23H34N6O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-N-(2-ethoxyethyl)-6-methylquinazoline-2-carboxamide |
| SMILES | CCOCCNC(=O)c1nc(N[C@H]2CCCCC2/N=C(/N)COC)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C23H34N6O3/c1-4-32-12-11-25-23(30)22-27-17-10-9-15(2)13-16(17)21(29-22)28-19-8-6-5-7-18(19)26-20(24)14-31-3/h9-10,13,18-19H,4-8,11-12,14H2,1-3H3,(H2,24,26)(H,25,30)(H,27,28,29)/t18?,19-/m0/s1 |
| InChIKey | PVPMAIFREWEKMZ-GGYWPGCISA-N |
| XLogP | 2.43 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|