C26H35Cl2N7O2 — CID 68584092
4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[2-(4-methoxyphenyl)ethyl]-6-methylquinazoline-2-carboxamide;dihydrochloride (PubChem CID 68584092) has the molecular formula C26H35Cl2N7O2 and a molecular weight of 548.52 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[2-(4-methoxyphenyl)ethyl]-6-methylquinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[2-(4-methoxyphenyl)ethyl]-6-methylquinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68584092 |
| Molecular Formula | C26H35Cl2N7O2 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[2-(4-methoxyphenyl)ethyl]-6-methylquinazoline-2-carboxamide;dihydrochloride |
| SMILES | COc1ccc(CCNC(=O)c2nc(N[C@H]3CCCC[C@H]3N=C(N)N)c3cc(C)ccc3n2)cc1.Cl.Cl |
| InChI | InChI=1S/C26H33N7O2.2ClH/c1-16-7-12-20-19(15-16)23(31-21-5-3-4-6-22(21)32-26(27)28)33-24(30-20)25(34)29-14-13-17-8-10-18(35-2)11-9-17;;/h7-12,15,21-22H,3-6,13-14H2,1-2H3,(H,29,34)(H4,27,28,32)(H,30,31,33);2*1H/t21-,22+;;/m0../s1 |
| InChIKey | XNKDNJCLKZSMSP-VSIGASKDSA-N |
| XLogP | 3.76 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|