C35H37F6N7O5 — CID 87505026
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[2-(4-phenylphenyl)ethyl]quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87505026) has the molecular formula C35H37F6N7O5 and a molecular weight of 749.71 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[2-(4-phenylphenyl)ethyl]quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[2-(4-phenylphenyl)ethyl]quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87505026 |
| Molecular Formula | C35H37F6N7O5 |
| Molecular Weight | 749.71 g/mol |
| Exact Mass | 749.28 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[2-(4-phenylphenyl)ethyl]quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2nc(C(=O)NCCc3ccc(-c4ccccc4)cc3)nc(NC3CCCCC3N=C(N)N)c2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H35N7O.2C2HF3O2/c1-20-11-16-25-24(19-20)28(36-26-9-5-6-10-27(26)37-31(32)33)38-29(35-25)30(39)34-18-17-21-12-14-23(15-13-21)22-7-3-2-4-8-22;2*3-2(4,5)1(6)7/h2-4,7-8,11-16,19,26-27H,5-6,9-10,17-18H2,1H3,(H,34,39)(H4,32,33,37)(H,35,36,38);2*(H,6,7) |
| InChIKey | DJXRHGFFXBBKON-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 205.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|