C30H35F6N7O5S — CID 87506252
N-(2-benzylsulfanylethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87506252) has the molecular formula C30H35F6N7O5S and a molecular weight of 719.71 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(2-benzylsulfanylethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87506252 |
| Molecular Formula | C30H35F6N7O5S |
| Molecular Weight | 719.71 g/mol |
| Exact Mass | 719.23 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2nc(C(=O)NCCSCc3ccccc3)nc(NC3CCCCC3N=C(N)N)c2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H33N7OS.2C2HF3O2/c1-17-11-12-20-19(15-17)23(31-21-9-5-6-10-22(21)32-26(27)28)33-24(30-20)25(34)29-13-14-35-16-18-7-3-2-4-8-18;2*3-2(4,5)1(6)7/h2-4,7-8,11-12,15,21-22H,5-6,9-10,13-14,16H2,1H3,(H,29,34)(H4,27,28,32)(H,30,31,33);2*(H,6,7) |
| InChIKey | BPFZRJNEKNDCGN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 205.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|