C25H29N7O3 — CID 87505012
N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide (PubChem CID 87505012) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87505012 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NCc3ccc4c(c3)OCO4)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H29N7O3/c1-14-6-8-17-16(10-14)22(30-18-4-2-3-5-19(18)31-25(26)27)32-23(29-17)24(33)28-12-15-7-9-20-21(11-15)35-13-34-20/h6-11,18-19H,2-5,12-13H2,1H3,(H,28,33)(H4,26,27,31)(H,29,30,32) |
| InChIKey | OPJMWFPCMQRWJA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 149.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|