C23H33N7O2 — CID 68581555
2-[(1R,2S)-2-[[2-[(2S)-2-(methoxymethyl)pyrrolidine-1-carbonyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine (PubChem CID 68581555) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[[2-[(2S)-2-(methoxymethyl)pyrrolidine-1-carbonyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine.
| Compound Name | 2-[(1R,2S)-2-[[2-[(2S)-2-(methoxymethyl)pyrrolidine-1-carbonyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 68581555 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[(1R,2S)-2-[[2-[(2S)-2-(methoxymethyl)pyrrolidine-1-carbonyl]-6-methylquinazolin-4-yl]amino]cyclohexyl]guanidine |
| SMILES | COC[C@@H]1CCCN1C(=O)c1nc(N[C@H]2CCCCC2N=C(N)N)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C23H33N7O2/c1-14-9-10-17-16(12-14)20(27-18-7-3-4-8-19(18)28-23(24)25)29-21(26-17)22(31)30-11-5-6-15(30)13-32-2/h9-10,12,15,18-19H,3-8,11,13H2,1-2H3,(H4,24,25,28)(H,26,27,29)/t15-,18-,19?/m0/s1 |
| InChIKey | QMYJLCWOLXKMFE-SIYBWXAISA-N |
| XLogP | 2.19 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|