C21H32N8O — CID 68584103
N-(1-amino-2-methylpropan-2-yl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide (PubChem CID 68584103) has the molecular formula C21H32N8O and a molecular weight of 412.54 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 68584103 |
| Molecular Formula | C21H32N8O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NC(C)(C)CN)nc(N[C@H]3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C21H32N8O/c1-12-8-9-14-13(10-12)17(26-15-6-4-5-7-16(15)27-20(23)24)28-18(25-14)19(30)29-21(2,3)11-22/h8-10,15-16H,4-7,11,22H2,1-3H3,(H,29,30)(H4,23,24,27)(H,25,26,28)/t15-,16?/m0/s1 |
| InChIKey | XGEOTNPUFAFLEZ-VYRBHSGPSA-N |
| XLogP | 1.40 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|