C24H35N7O3 — CID 87504914
methyl 2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-3-methylpentanoate (PubChem CID 87504914) has the molecular formula C24H35N7O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is methyl 2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 87504914 |
| Molecular Formula | C24H35N7O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | methyl 2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)c1nc(NC2CCCCC2N=C(N)N)c2cc(C)ccc2n1)C(=O)OC |
| InChI | InChI=1S/C24H35N7O3/c1-5-14(3)19(23(33)34-4)30-22(32)21-27-16-11-10-13(2)12-15(16)20(31-21)28-17-8-6-7-9-18(17)29-24(25)26/h10-12,14,17-19H,5-9H2,1-4H3,(H,30,32)(H4,25,26,29)(H,27,28,31) |
| InChIKey | MIJBQIFJAFLVNX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|