C22H31N7O3 — CID 87506406
ethyl 3-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]propanoate (PubChem CID 87506406) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is ethyl 3-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 87506406 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | ethyl 3-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1nc(NC2CCCCC2N=C(N)N)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C22H31N7O3/c1-3-32-18(30)10-11-25-21(31)20-26-15-9-8-13(2)12-14(15)19(29-20)27-16-6-4-5-7-17(16)28-22(23)24/h8-9,12,16-17H,3-7,10-11H2,1-2H3,(H,25,31)(H4,23,24,28)(H,26,27,29) |
| InChIKey | MSSWGAONKLTHMA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|