C23H35N7O — CID 68581712
4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(3,3-dimethylbutyl)-6-methylquinazoline-2-carboxamide (PubChem CID 68581712) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(3,3-dimethylbutyl)-6-methylquinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(3,3-dimethylbutyl)-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 68581712 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(3,3-dimethylbutyl)-6-methylquinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NCCC(C)(C)C)nc(N[C@H]3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C23H35N7O/c1-14-9-10-16-15(13-14)19(28-17-7-5-6-8-18(17)29-22(24)25)30-20(27-16)21(31)26-12-11-23(2,3)4/h9-10,13,17-18H,5-8,11-12H2,1-4H3,(H,26,31)(H4,24,25,29)(H,27,28,30)/t17-,18?/m0/s1 |
| InChIKey | AMKCTENOQZXCQA-ZENAZSQFSA-N |
| XLogP | 3.10 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|