C20H27FN6O — CID 87542175
4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-(2-fluoroethyl)-6-methylquinazoline-2-carboxamide (PubChem CID 87542175) has the molecular formula C20H27FN6O and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-(2-fluoroethyl)-6-methylquinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-(2-fluoroethyl)-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87542175 |
| Molecular Formula | C20H27FN6O |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-(2-fluoroethyl)-6-methylquinazoline-2-carboxamide |
| SMILES | C/C(N)=N\C1CCCC[C@@H]1Nc1nc(C(=O)NCCF)nc2ccc(C)cc12 |
| InChI | InChI=1S/C20H27FN6O/c1-12-7-8-15-14(11-12)18(27-19(25-15)20(28)23-10-9-21)26-17-6-4-3-5-16(17)24-13(2)22/h7-8,11,16-17H,3-6,9-10H2,1-2H3,(H2,22,24)(H,23,28)(H,25,26,27)/t16?,17-/m0/s1 |
| InChIKey | ZWXSPGKTRCLRMQ-DJNXLDHESA-N |
| XLogP | 2.74 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|