C24H36N6O3 — CID 16660764
4-[[(1S,2R)-2-[(1-amino-3-methoxypropylidene)amino]cyclohexyl]amino]-N-(3-methoxypropyl)-6-methylquinazoline-2-carboxamide (PubChem CID 16660764) has the molecular formula C24H36N6O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[(1-amino-3-methoxypropylidene)amino]cyclohexyl]amino]-N-(3-methoxypropyl)-6-methylquinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-[(1-amino-3-methoxypropylidene)amino]cyclohexyl]amino]-N-(3-methoxypropyl)-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 16660764 |
| Molecular Formula | C24H36N6O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 4-[[(1S,2R)-2-[(1-amino-3-methoxypropylidene)amino]cyclohexyl]amino]-N-(3-methoxypropyl)-6-methylquinazoline-2-carboxamide |
| SMILES | COCCCNC(=O)c1nc(N[C@H]2CCCCC2/N=C(/N)CCOC)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C24H36N6O3/c1-16-9-10-18-17(15-16)22(30-23(28-18)24(31)26-12-6-13-32-2)29-20-8-5-4-7-19(20)27-21(25)11-14-33-3/h9-10,15,19-20H,4-8,11-14H2,1-3H3,(H2,25,27)(H,26,31)(H,28,29,30)/t19?,20-/m0/s1 |
| InChIKey | ZEDYICSCPWYWEJ-ANYOKISRSA-N |
| XLogP | 2.82 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|