C22H33N7O — CID 68581880
4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3-methylbutyl)quinazoline-2-carboxamide (PubChem CID 68581880) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3-methylbutyl)quinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3-methylbutyl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 68581880 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3-methylbutyl)quinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NCCC(C)C)nc(N[C@H]3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C22H33N7O/c1-13(2)10-11-25-21(30)20-26-16-9-8-14(3)12-15(16)19(29-20)27-17-6-4-5-7-18(17)28-22(23)24/h8-9,12-13,17-18H,4-7,10-11H2,1-3H3,(H,25,30)(H4,23,24,28)(H,26,27,29)/t17-,18?/m0/s1 |
| InChIKey | AHXJDCQLQCDQKT-ZENAZSQFSA-N |
| XLogP | 2.71 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|