C23H26ClN7O2 — CID 68582038
6-chloro-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(4-methoxyphenyl)quinazoline-2-carboxamide (PubChem CID 68582038) has the molecular formula C23H26ClN7O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is 6-chloro-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(4-methoxyphenyl)quinazoline-2-carboxamide.
| Compound Name | 6-chloro-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(4-methoxyphenyl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 68582038 |
| Molecular Formula | C23H26ClN7O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 6-chloro-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-(4-methoxyphenyl)quinazoline-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nc(N[C@H]3CCCCC3N=C(N)N)c3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C23H26ClN7O2/c1-33-15-9-7-14(8-10-15)27-22(32)21-28-17-11-6-13(24)12-16(17)20(31-21)29-18-4-2-3-5-19(18)30-23(25)26/h6-12,18-19H,2-5H2,1H3,(H,27,32)(H4,25,26,30)(H,28,29,31)/t18-,19?/m0/s1 |
| InChIKey | DVGQIMUHCJMISX-OYKVQYDMSA-N |
| XLogP | 3.54 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|