C20H28Cl2F3N7O2 — CID 87542154
4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-6-methyl-N-(2,2,2-trifluoroethyl)quinazoline-2-carboxamide;dihydrochloride (PubChem CID 87542154) has the molecular formula C20H28Cl2F3N7O2 and a molecular weight of 526.39 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-6-methyl-N-(2,2,2-trifluoroethyl)quinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-6-methyl-N-(2,2,2-trifluoroethyl)quinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 87542154 |
| Molecular Formula | C20H28Cl2F3N7O2 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-6-methyl-N-(2,2,2-trifluoroethyl)quinazoline-2-carboxamide;dihydrochloride |
| SMILES | CON/C(N)=N/[C@@H]1CCCC[C@@H]1Nc1nc(C(=O)NCC(F)(F)F)nc2ccc(C)cc12.Cl.Cl |
| InChI | InChI=1S/C20H26F3N7O2.2ClH/c1-11-7-8-13-12(9-11)16(29-17(26-13)18(31)25-10-20(21,22)23)27-14-5-3-4-6-15(14)28-19(24)30-32-2;;/h7-9,14-15H,3-6,10H2,1-2H3,(H,25,31)(H3,24,28,30)(H,26,27,29);2*1H/t14-,15+;;/m0../s1 |
| InChIKey | OUEPSACCFKRUCB-FZMMWMHASA-N |
| XLogP | 3.26 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|