C21H25N7O2 — CID 87504974
N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]furan-2-carboxamide (PubChem CID 87504974) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 87504974 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]furan-2-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3ccco3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C21H25N7O2/c1-12-8-9-14-13(11-12)18(24-15-5-2-3-6-16(15)25-20(22)23)27-21(26-14)28-19(29)17-7-4-10-30-17/h4,7-11,15-16H,2-3,5-6H2,1H3,(H4,22,23,25)(H2,24,26,27,28,29) |
| InChIKey | WVFAMRPGZUIGCF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|