C22H28N8O2 — CID 87513875
N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 87513875) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 87513875 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3c(C)noc3C)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C22H28N8O2/c1-11-8-9-15-14(10-11)19(25-16-6-4-5-7-17(16)26-21(23)24)28-22(27-15)29-20(31)18-12(2)30-32-13(18)3/h8-10,16-17H,4-7H2,1-3H3,(H4,23,24,26)(H2,25,27,28,29,31) |
| InChIKey | CXYSDCQQXIRGDY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|