C21H23N7O — CID 10293712
2-[4-[[6-methoxy-2-(2-pyridin-2-ylethynyl)quinazolin-4-yl]amino]butyl]guanidine (PubChem CID 10293712) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[4-[[6-methoxy-2-(2-pyridin-2-ylethynyl)quinazolin-4-yl]amino]butyl]guanidine.
| Compound Name | 2-[4-[[6-methoxy-2-(2-pyridin-2-ylethynyl)quinazolin-4-yl]amino]butyl]guanidine |
|---|---|
| PubChem CID | 10293712 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[4-[[6-methoxy-2-(2-pyridin-2-ylethynyl)quinazolin-4-yl]amino]butyl]guanidine |
| SMILES | COc1ccc2nc(C#Cc3ccccn3)nc(NCCCCN=C(N)N)c2c1 |
| InChI | InChI=1S/C21H23N7O/c1-29-16-8-9-18-17(14-16)20(25-12-4-5-13-26-21(22)23)28-19(27-18)10-7-15-6-2-3-11-24-15/h2-3,6,8-9,11,14H,4-5,12-13H2,1H3,(H4,22,23,26)(H,25,27,28) |
| InChIKey | UYUNDEZTKBDQET-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|