About dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine
dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine (PubChem CID 6331885) has the molecular formula C14H21N6O4+
and a molecular weight of 337.36 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine.
Molecular Properties
| Compound Name | dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine |
| PubChem CID | 6331885 |
| Molecular Formula | C14H21N6O4+ |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine |
| SMILES | COc1cc(NCCCN=C(N)N)c2ncccc2c1.O=[N+](O)O |
| InChI | InChI=1S/C14H19N5O.H2NO3/c1-20-11-8-10-4-2-5-18-13(10)12(9-11)17-6-3-7-19-14(15)16;2-1(3)4/h2,4-5,8-9,17H,3,6-7H2,1H3,(H4,15,16,19);(H2,2,3,4)/q;+1 |
| InChIKey | TWFJYKIPWAQPCY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 159.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine?
The IUPAC name of dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine (CID 6331885) is dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine.
What is the SMILES notation for dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine?
The canonical SMILES for dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine is COc1cc(NCCCN=C(N)N)c2ncccc2c1.O=[N+](O)O.
What is the InChIKey of dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine?
The InChIKey is TWFJYKIPWAQPCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O.H2NO3/c1-20-11-8-10-4-2-5-18-13(10)12(9-11)17-6-3-7-19-14(15)16;2-1(3)4/h2,4-5,8-9,17H,3,6-7H2,1H3,(H4,15,16,19);(H2,2,3,4)/q;+1.
What are the key properties of dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine?
dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine has a molecular weight of 337.36 g/mol, XLogP of 0.86, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)azanium;2-[3-[(6-methoxyquinolin-8-yl)amino]propyl]guanidine is sourced from PubChem (CID 6331885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).