C17H26ClN7O — CID 54611977
1-[N'-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride (PubChem CID 54611977) has the molecular formula C17H26ClN7O and a molecular weight of 379.90 g/mol. Its IUPAC name is 1-[N'-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride.
| Compound Name | 1-[N'-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 54611977 |
| Molecular Formula | C17H26ClN7O |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[N'-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride |
| SMILES | COc1cc(NCC/N=C(\N)N/C(N)=N/C(C)C)c2ncccc2c1.Cl |
| InChI | InChI=1S/C17H25N7O.ClH/c1-11(2)23-17(19)24-16(18)22-8-7-20-14-10-13(25-3)9-12-5-4-6-21-15(12)14;/h4-6,9-11,20H,7-8H2,1-3H3,(H5,18,19,22,23,24);1H |
| InChIKey | IIBDTHHSRQRWAP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|