C32H42Cl2N6O4 — CID 90664753
N,N'-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]oxamide;dihydrochloride (PubChem CID 90664753) has the molecular formula C32H42Cl2N6O4 and a molecular weight of 645.63 g/mol. Its IUPAC name is N,N'-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]oxamide;dihydrochloride.
| Compound Name | N,N'-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]oxamide;dihydrochloride |
|---|---|
| PubChem CID | 90664753 |
| Molecular Formula | C32H42Cl2N6O4 |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | N,N'-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]oxamide;dihydrochloride |
| SMILES | COc1cc(NC(C)CCCNC(=O)C(=O)NCCCC(C)Nc2cc(OC)cc3cccnc23)c2ncccc2c1.Cl.Cl |
| InChI | InChI=1S/C32H40N6O4.2ClH/c1-21(37-27-19-25(41-3)17-23-11-7-13-33-29(23)27)9-5-15-35-31(39)32(40)36-16-6-10-22(2)38-28-20-26(42-4)18-24-12-8-14-34-30(24)28;;/h7-8,11-14,17-22,37-38H,5-6,9-10,15-16H2,1-4H3,(H,35,39)(H,36,40);2*1H |
| InChIKey | APDPUUGAYASLJH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|