C21H31N5O4 — CID 70681420
(2R)-2-amino-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]pentanoic acid (PubChem CID 70681420) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2R)-2-amino-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]pentanoic acid.
| Compound Name | (2R)-2-amino-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 70681420 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (2R)-2-amino-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]pentanoic acid |
| SMILES | COc1cc(NC(C)CCCNC(=O)NCCC[C@@H](N)C(=O)O)c2ncccc2c1 |
| InChI | InChI=1S/C21H31N5O4/c1-14(6-3-10-24-21(29)25-11-5-8-17(22)20(27)28)26-18-13-16(30-2)12-15-7-4-9-23-19(15)18/h4,7,9,12-14,17,26H,3,5-6,8,10-11,22H2,1-2H3,(H,27,28)(H2,24,25,29)/t14?,17-/m1/s1 |
| InChIKey | BVCLOIZGDGVBIS-FBMWCMRBSA-N |
| XLogP | 2.32 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|