C23H28N6O4 — CID 134131561
1-(3-hydroxyphenyl)-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea (PubChem CID 134131561) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea.
| Compound Name | 1-(3-hydroxyphenyl)-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea |
|---|---|
| PubChem CID | 134131561 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-(3-hydroxyphenyl)-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea |
| SMILES | COc1cc(NC(C)CCCNC(=O)NNC(=O)Nc2cccc(O)c2)c2ncccc2c1 |
| InChI | InChI=1S/C23H28N6O4/c1-15(26-20-14-19(33-2)12-16-7-5-10-24-21(16)20)6-4-11-25-22(31)28-29-23(32)27-17-8-3-9-18(30)13-17/h3,5,7-10,12-15,26,30H,4,6,11H2,1-2H3,(H2,25,28,31)(H2,27,29,32) |
| InChIKey | BYACXROQRDESQJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|