C20H33N5O2 — CID 21115016
1-N,1-N-diethyl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;urea (PubChem CID 21115016) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;urea.
| Compound Name | 1-N,1-N-diethyl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;urea |
|---|---|
| PubChem CID | 21115016 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;urea |
| SMILES | CCN(CC)CCCC(C)Nc1cc(OC)cc2cccnc12.NC(N)=O |
| InChI | InChI=1S/C19H29N3O.CH4N2O/c1-5-22(6-2)12-8-9-15(3)21-18-14-17(23-4)13-16-10-7-11-20-19(16)18;2-1(3)4/h7,10-11,13-15,21H,5-6,8-9,12H2,1-4H3;(H4,2,3,4) |
| InChIKey | NZOLKJIIWOFIJC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |