C33H40N4O3 — CID 42724213
N-[[4-(dimethylamino)phenyl]methyl]-2-(4-methoxyphenyl)-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]acetamide (PubChem CID 42724213) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(4-methoxyphenyl)-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(4-methoxyphenyl)-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]acetamide |
|---|---|
| PubChem CID | 42724213 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(4-methoxyphenyl)-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]acetamide |
| SMILES | COc1ccc(CC(=O)N(CCCC(C)Nc2cc(OC)cc3cccnc23)Cc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H40N4O3/c1-24(35-31-22-30(40-5)21-27-9-6-18-34-33(27)31)8-7-19-37(23-26-10-14-28(15-11-26)36(2)3)32(38)20-25-12-16-29(39-4)17-13-25/h6,9-18,21-22,24,35H,7-8,19-20,23H2,1-5H3 |
| InChIKey | XHFIGRHLONZSFU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|