C37H44ClN7O4 — CID 53324732
3-N,5-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-3,5-dicarboxamide;hydrochloride (PubChem CID 53324732) has the molecular formula C37H44ClN7O4 and a molecular weight of 686.26 g/mol. Its IUPAC name is 3-N,5-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-3,5-dicarboxamide;hydrochloride.
| Compound Name | 3-N,5-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-3,5-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 53324732 |
| Molecular Formula | C37H44ClN7O4 |
| Molecular Weight | 686.26 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | 3-N,5-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-3,5-dicarboxamide;hydrochloride |
| SMILES | COc1cc(NC(C)CCCNC(=O)c2cncc(C(=O)NCCCC(C)Nc3cc(OC)cc4cccnc34)c2)c2ncccc2c1.Cl |
| InChI | InChI=1S/C37H43N7O4.ClH/c1-24(43-32-20-30(47-3)18-26-11-7-13-39-34(26)32)9-5-15-41-36(45)28-17-29(23-38-22-28)37(46)42-16-6-10-25(2)44-33-21-31(48-4)19-27-12-8-14-40-35(27)33;/h7-8,11-14,17-25,43-44H,5-6,9-10,15-16H2,1-4H3,(H,41,45)(H,42,46);1H |
| InChIKey | VZYNOLFBHLDSTG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.26 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|