C22H32N6O4 — CID 135122121
1-[1-(hydroxymethyl)cyclobutyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea (PubChem CID 135122121) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[1-(hydroxymethyl)cyclobutyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea.
| Compound Name | 1-[1-(hydroxymethyl)cyclobutyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea |
|---|---|
| PubChem CID | 135122121 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[1-(hydroxymethyl)cyclobutyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea |
| SMILES | COc1cc(NC(C)CCCNC(=O)NNC(=O)NC2(CO)CCC2)c2ncccc2c1 |
| InChI | InChI=1S/C22H32N6O4/c1-15(25-18-13-17(32-2)12-16-7-4-10-23-19(16)18)6-3-11-24-20(30)27-28-21(31)26-22(14-29)8-5-9-22/h4,7,10,12-13,15,25,29H,3,5-6,8-9,11,14H2,1-2H3,(H2,24,27,30)(H2,26,28,31) |
| InChIKey | SRIMSTWLCIRGAO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|