C21H30N4O3 — CID 135122058
1-[(1S,3R)-3-hydroxycyclopentyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]urea (PubChem CID 135122058) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[(1S,3R)-3-hydroxycyclopentyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]urea.
| Compound Name | 1-[(1S,3R)-3-hydroxycyclopentyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]urea |
|---|---|
| PubChem CID | 135122058 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1-[(1S,3R)-3-hydroxycyclopentyl]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]urea |
| SMILES | COc1cc(NC(C)CCCNC(=O)N[C@H]2CC[C@@H](O)C2)c2ncccc2c1 |
| InChI | InChI=1S/C21H30N4O3/c1-14(5-3-10-23-21(27)25-16-7-8-17(26)12-16)24-19-13-18(28-2)11-15-6-4-9-22-20(15)19/h4,6,9,11,13-14,16-17,24,26H,3,5,7-8,10,12H2,1-2H3,(H2,23,25,27)/t14?,16-,17+/m0/s1 |
| InChIKey | BZOQKOKWLRSUGH-MWSTZMHHSA-N |
| XLogP | 3.04 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|