C32H37N7O5 — CID 118713297
1-[bis(4-methoxyphenyl)methylideneamino]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea (PubChem CID 118713297) has the molecular formula C32H37N7O5 and a molecular weight of 599.69 g/mol. Its IUPAC name is 1-[bis(4-methoxyphenyl)methylideneamino]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea.
| Compound Name | 1-[bis(4-methoxyphenyl)methylideneamino]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea |
|---|---|
| PubChem CID | 118713297 |
| Molecular Formula | C32H37N7O5 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | 1-[bis(4-methoxyphenyl)methylideneamino]-3-[4-[(6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]urea |
| SMILES | COc1ccc(C(=NNC(=O)NNC(=O)NCCCC(C)Nc2cc(OC)cc3cccnc23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H37N7O5/c1-21(35-28-20-27(44-4)19-24-8-6-17-33-30(24)28)7-5-18-34-31(40)37-39-32(41)38-36-29(22-9-13-25(42-2)14-10-22)23-11-15-26(43-3)16-12-23/h6,8-17,19-21,35H,5,7,18H2,1-4H3,(H2,34,37,40)(H2,38,39,41) |
| InChIKey | UHBXFYHKZIWKRI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|