C24H31N5O3 — CID 71593216
(2R)-3-amino-2-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]propanamide (PubChem CID 71593216) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2R)-3-amino-2-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]propanamide.
| Compound Name | (2R)-3-amino-2-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]propanamide |
|---|---|
| PubChem CID | 71593216 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (2R)-3-amino-2-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]propanamide |
| SMILES | COc1cc(NC(C)CCCNC(=O)[C@@H](CN)NC(O)=C2C=CC=C2)c2ncccc2c1 |
| InChI | InChI=1S/C24H31N5O3/c1-16(28-20-14-19(32-2)13-18-10-6-11-26-22(18)20)7-5-12-27-24(31)21(15-25)29-23(30)17-8-3-4-9-17/h3-4,6,8-11,13-14,16,21,28-30H,5,7,12,15,25H2,1-2H3,(H,27,31)/t16?,21-/m1/s1 |
| InChIKey | RQQWBIZVOLUUQB-CAWMZFRYSA-N |
| XLogP | 2.75 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|