C25H38N6O5 — CID 70687680
(2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid (PubChem CID 70687680) has the molecular formula C25H38N6O5 and a molecular weight of 502.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70687680 |
| Molecular Formula | C25H38N6O5 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]-5-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid |
| SMILES | COc1cc(NC(C)CCCNC(=O)CC[C@H](NC(=O)[C@@H](N)CCCN)C(=O)O)c2ncccc2c1 |
| InChI | InChI=1S/C25H38N6O5/c1-16(30-21-15-18(36-2)14-17-7-5-13-29-23(17)21)6-4-12-28-22(32)10-9-20(25(34)35)31-24(33)19(27)8-3-11-26/h5,7,13-16,19-20,30H,3-4,6,8-12,26-27H2,1-2H3,(H,28,32)(H,31,33)(H,34,35)/t16?,19-,20-/m0/s1 |
| InChIKey | MXOFBIXXYJNENE-RFFXKOPCSA-N |
| XLogP | 1.36 |
| TPSA | 181.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|