C33H54N8O5 — CID 10100694
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]hexanamide (PubChem CID 10100694) has the molecular formula C33H54N8O5 and a molecular weight of 642.85 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]hexanamide |
|---|---|
| PubChem CID | 10100694 |
| Molecular Formula | C33H54N8O5 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.42 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]hexanamide |
| SMILES | COc1cc(NC(C)CCCNC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)N)c2ncccc2c1 |
| InChI | InChI=1S/C33H54N8O5/c1-20(2)17-28(41-30(42)22(4)35)33(45)39-23(5)31(43)40-26(13-7-8-14-34)32(44)37-16-9-11-21(3)38-27-19-25(46-6)18-24-12-10-15-36-29(24)27/h10,12,15,18-23,26,28,38H,7-9,11,13-14,16-17,34-35H2,1-6H3,(H,37,44)(H,39,45)(H,40,43)(H,41,42)/t21?,22-,23-,26-,28-/m0/s1 |
| InChIKey | ZWCDUECNUWDQII-XEEGBFTGSA-N |
| XLogP | 1.94 |
| TPSA | 202.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|