C28H28N4O — CID 39070210
(4S)-1-N-acridin-9-yl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine (PubChem CID 39070210) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is (4S)-1-N-acridin-9-yl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine.
| Compound Name | (4S)-1-N-acridin-9-yl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 39070210 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (4S)-1-N-acridin-9-yl-4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine |
| SMILES | COc1cc(N[C@@H](C)CCCNc2c3ccccc3nc3ccccc23)c2ncccc2c1 |
| InChI | InChI=1S/C28H28N4O/c1-19(31-26-18-21(33-2)17-20-10-8-16-29-27(20)26)9-7-15-30-28-22-11-3-5-13-24(22)32-25-14-6-4-12-23(25)28/h3-6,8,10-14,16-19,31H,7,9,15H2,1-2H3,(H,30,32)/t19-/m0/s1 |
| InChIKey | QNJMGYLKKDFDOQ-IBGZPJMESA-N |
| XLogP | 6.64 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|