C27H45N9O3 — CID 10650183
(2S)-2,6-diamino-N-[(2S)-5-(diaminomethylideneamino)-1-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-1-oxopentan-2-yl]hexanamide (PubChem CID 10650183) has the molecular formula C27H45N9O3 and a molecular weight of 543.72 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-5-(diaminomethylideneamino)-1-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-5-(diaminomethylideneamino)-1-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 10650183 |
| Molecular Formula | C27H45N9O3 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-5-(diaminomethylideneamino)-1-[4-[(6-methoxyquinolin-8-yl)amino]pentylamino]-1-oxopentan-2-yl]hexanamide |
| SMILES | COc1cc(NC(C)CCCNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CCCCN)c2ncccc2c1 |
| InChI | InChI=1S/C27H45N9O3/c1-18(35-23-17-20(39-2)16-19-9-6-13-32-24(19)23)8-5-14-33-26(38)22(11-7-15-34-27(30)31)36-25(37)21(29)10-3-4-12-28/h6,9,13,16-18,21-22,35H,3-5,7-8,10-12,14-15,28-29H2,1-2H3,(H,33,38)(H,36,37)(H4,30,31,34)/t18?,21-,22-/m0/s1 |
| InChIKey | SRGZPMCOHOHURN-VRJTXETASA-N |
| XLogP | 0.93 |
| TPSA | 208.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|