C30H48N8O5 — CID 71594787
2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid (PubChem CID 71594787) has the molecular formula C30H48N8O5 and a molecular weight of 600.77 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid.
| Compound Name | 2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71594787 |
| Molecular Formula | C30H48N8O5 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylamino]-5-oxopentanoic acid |
| SMILES | COc1cc(NC(C)CCCNC(=O)CCC(NC(=O)[C@H](N)CCCN=C(N)N)C(=O)O)c2nc(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C30H48N8O5/c1-18(36-23-17-20(43-5)16-19-10-12-24(30(2,3)4)38-26(19)23)8-6-14-34-25(39)13-11-22(28(41)42)37-27(40)21(31)9-7-15-35-29(32)33/h10,12,16-18,21-22,36H,6-9,11,13-15,31H2,1-5H3,(H,34,39)(H,37,40)(H,41,42)(H4,32,33,35)/t18?,21-,22?/m1/s1 |
| InChIKey | BDVKFAZNLOFFRM-NFOQDIRWSA-N |
| XLogP | 1.97 |
| TPSA | 220.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|