C26H41N5O4 — CID 71596352
2-amino-6-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]hexanoic acid (PubChem CID 71596352) has the molecular formula C26H41N5O4 and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-amino-6-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]hexanoic acid.
| Compound Name | 2-amino-6-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 71596352 |
| Molecular Formula | C26H41N5O4 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 2-amino-6-[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentylcarbamoylamino]hexanoic acid |
| SMILES | COc1cc(NC(C)CCCNC(=O)NCCCCC(N)C(=O)O)c2nc(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C26H41N5O4/c1-17(9-8-14-29-25(34)28-13-7-6-10-20(27)24(32)33)30-21-16-19(35-5)15-18-11-12-22(26(2,3)4)31-23(18)21/h11-12,15-17,20,30H,6-10,13-14,27H2,1-5H3,(H,32,33)(H2,28,29,34) |
| InChIKey | UEEZLBSNGCWXAP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|