C20H31N3O — CID 44568394
N',N'-dibutyl-N-(6-methoxyquinolin-8-yl)ethane-1,2-diamine (PubChem CID 44568394) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is N',N'-dibutyl-N-(6-methoxyquinolin-8-yl)ethane-1,2-diamine.
| Compound Name | N',N'-dibutyl-N-(6-methoxyquinolin-8-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 44568394 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N',N'-dibutyl-N-(6-methoxyquinolin-8-yl)ethane-1,2-diamine |
| SMILES | CCCCN(CCCC)CCNc1cc(OC)cc2cccnc12 |
| InChI | InChI=1S/C20H31N3O/c1-4-6-12-23(13-7-5-2)14-11-21-19-16-18(24-3)15-17-9-8-10-22-20(17)19/h8-10,15-16,21H,4-7,11-14H2,1-3H3 |
| InChIKey | OFOAJOZHNDBHKO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |