C13H19N6O4+ — CID 6332174
dihydroxy(oxo)azanium;2-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]guanidine (PubChem CID 6332174) has the molecular formula C13H19N6O4+ and a molecular weight of 323.33 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]guanidine.
| Compound Name | dihydroxy(oxo)azanium;2-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 6332174 |
| Molecular Formula | C13H19N6O4+ |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[2-[(6-methoxyquinolin-8-yl)amino]ethyl]guanidine |
| SMILES | COc1cc(NCCN=C(N)N)c2ncccc2c1.O=[N+](O)O |
| InChI | InChI=1S/C13H17N5O.H2NO3/c1-19-10-7-9-3-2-4-17-12(9)11(8-10)16-5-6-18-13(14)15;2-1(3)4/h2-4,7-8,16H,5-6H2,1H3,(H4,14,15,18);(H2,2,3,4)/q;+1 |
| InChIKey | JUVNUVOKFXUCBD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 159.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|