C20H31N7O — CID 76852179
1-(diaminomethylidene)-2-[5-[(6-methoxyquinolin-8-yl)amino]pentyl]-3-propan-2-ylguanidine (PubChem CID 76852179) has the molecular formula C20H31N7O and a molecular weight of 385.52 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[5-[(6-methoxyquinolin-8-yl)amino]pentyl]-3-propan-2-ylguanidine.
| Compound Name | 1-(diaminomethylidene)-2-[5-[(6-methoxyquinolin-8-yl)amino]pentyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 76852179 |
| Molecular Formula | C20H31N7O |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 1-(diaminomethylidene)-2-[5-[(6-methoxyquinolin-8-yl)amino]pentyl]-3-propan-2-ylguanidine |
| SMILES | COc1cc(NCCCCC/N=C(\N=C(N)N)NC(C)C)c2ncccc2c1 |
| InChI | InChI=1S/C20H31N7O/c1-14(2)26-20(27-19(21)22)25-10-6-4-5-9-23-17-13-16(28-3)12-15-8-7-11-24-18(15)17/h7-8,11-14,23H,4-6,9-10H2,1-3H3,(H5,21,22,25,26,27) |
| InChIKey | ZHVALJOVUUKLMF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|