C28H33Cl2N7O2 — CID 68581575
N-[4-[2-[2-[2-(diaminomethylideneamino)ethyl]phenyl]ethylamino]-6-methylquinazolin-2-yl]-4-methoxybenzamide;dihydrochloride (PubChem CID 68581575) has the molecular formula C28H33Cl2N7O2 and a molecular weight of 570.53 g/mol. Its IUPAC name is N-[4-[2-[2-[2-(diaminomethylideneamino)ethyl]phenyl]ethylamino]-6-methylquinazolin-2-yl]-4-methoxybenzamide;dihydrochloride.
| Compound Name | N-[4-[2-[2-[2-(diaminomethylideneamino)ethyl]phenyl]ethylamino]-6-methylquinazolin-2-yl]-4-methoxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 68581575 |
| Molecular Formula | C28H33Cl2N7O2 |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | N-[4-[2-[2-[2-(diaminomethylideneamino)ethyl]phenyl]ethylamino]-6-methylquinazolin-2-yl]-4-methoxybenzamide;dihydrochloride |
| SMILES | COc1ccc(C(=O)Nc2nc(NCCc3ccccc3CCN=C(N)N)c3cc(C)ccc3n2)cc1.Cl.Cl |
| InChI | InChI=1S/C28H31N7O2.2ClH/c1-18-7-12-24-23(17-18)25(31-15-13-19-5-3-4-6-20(19)14-16-32-27(29)30)34-28(33-24)35-26(36)21-8-10-22(37-2)11-9-21;;/h3-12,17H,13-16H2,1-2H3,(H4,29,30,32)(H2,31,33,34,35,36);2*1H |
| InChIKey | YIBVTOSIUHIRIZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|