About N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide
N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide (PubChem CID 69022848) has the molecular formula C22H24ClN5O2
and a molecular weight of 425.92 g/mol. Its IUPAC name is N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide.
Molecular Properties
| Compound Name | N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide |
| PubChem CID | 69022848 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide |
| SMILES | COc1ccc2nc(NC(=O)c3ccc(Cl)cc3)nc(N[C@H]3CCCC[C@H]3N)c2c1 |
| InChI | InChI=1S/C22H24ClN5O2/c1-30-15-10-11-18-16(12-15)20(25-19-5-3-2-4-17(19)24)27-22(26-18)28-21(29)13-6-8-14(23)9-7-13/h6-12,17,19H,2-5,24H2,1H3,(H2,25,26,27,28,29)/t17-,19+/m1/s1 |
| InChIKey | XBZYFSQKUKLURF-MJGOQNOKSA-N |
| XLogP | 4.23 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide?
The IUPAC name of N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide (CID 69022848) is N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide.
What is the SMILES notation for N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide?
The canonical SMILES for N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide is COc1ccc2nc(NC(=O)c3ccc(Cl)cc3)nc(N[C@H]3CCCC[C@H]3N)c2c1.
What is the InChIKey of N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide?
The InChIKey is XBZYFSQKUKLURF-MJGOQNOKSA-N. The full InChI is InChI=1S/C22H24ClN5O2/c1-30-15-10-11-18-16(12-15)20(25-19-5-3-2-4-17(19)24)27-22(26-18)28-21(29)13-6-8-14(23)9-7-13/h6-12,17,19H,2-5,24H2,1H3,(H2,25,26,27,28,29)/t17-,19+/m1/s1.
What are the key properties of N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide?
N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide has a molecular weight of 425.92 g/mol, XLogP of 4.23, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[(1S,2R)-2-aminocyclohexyl]amino]-6-methoxyquinazolin-2-yl]-4-chlorobenzamide is sourced from PubChem (CID 69022848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).