C16H24N4 — CID 161032824
methane;6-methyl-4-N-propan-2-yl-2-N-prop-2-enylquinazoline-2,4-diamine (PubChem CID 161032824) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is methane;6-methyl-4-N-propan-2-yl-2-N-prop-2-enylquinazoline-2,4-diamine.
| Compound Name | methane;6-methyl-4-N-propan-2-yl-2-N-prop-2-enylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 161032824 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | methane;6-methyl-4-N-propan-2-yl-2-N-prop-2-enylquinazoline-2,4-diamine |
| SMILES | C.C=CCNc1nc(NC(C)C)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C15H20N4.CH4/c1-5-8-16-15-18-13-7-6-11(4)9-12(13)14(19-15)17-10(2)3;/h5-7,9-10H,1,8H2,2-4H3,(H2,16,17,18,19);1H4 |
| InChIKey | TZVSBKBLWDODQL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|