C13H16ClN3 — CID 114693032
2-chloro-6-ethyl-N-propan-2-ylquinazolin-4-amine (PubChem CID 114693032) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-propan-2-ylquinazolin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-propan-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 114693032 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-chloro-6-ethyl-N-propan-2-ylquinazolin-4-amine |
| SMILES | CCc1ccc2nc(Cl)nc(NC(C)C)c2c1 |
| InChI | InChI=1S/C13H16ClN3/c1-4-9-5-6-11-10(7-9)12(15-8(2)3)17-13(14)16-11/h5-8H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | JQKUCXZWSDVLRJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |