C20H32N4 — CID 157492585
4-N-heptyl-6-methyl-2-N-prop-2-enylquinazoline-2,4-diamine;methane (PubChem CID 157492585) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-N-heptyl-6-methyl-2-N-prop-2-enylquinazoline-2,4-diamine;methane.
| Compound Name | 4-N-heptyl-6-methyl-2-N-prop-2-enylquinazoline-2,4-diamine;methane |
|---|---|
| PubChem CID | 157492585 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 4-N-heptyl-6-methyl-2-N-prop-2-enylquinazoline-2,4-diamine;methane |
| SMILES | C.C=CCNc1nc(NCCCCCCC)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C19H28N4.CH4/c1-4-6-7-8-9-13-20-18-16-14-15(3)10-11-17(16)22-19(23-18)21-12-5-2;/h5,10-11,14H,2,4,6-9,12-13H2,1,3H3,(H2,20,21,22,23);1H4 |
| InChIKey | BXLNOXXXQCOWSH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|