C12H21ClN6O — CID 83118369
3-[2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83118369) has the molecular formula C12H21ClN6O and a molecular weight of 300.79 g/mol. Its IUPAC name is 3-[2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83118369 |
| Molecular Formula | C12H21ClN6O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-[2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CCCNc1ncc(Cl)c(NCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C12H21ClN6O/c1-4-5-15-11-17-8-9(13)10(18-11)14-6-7-16-12(20)19(2)3/h8H,4-7H2,1-3H3,(H,16,20)(H2,14,15,17,18) |
| InChIKey | FUZXGVXSICWASN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|