C10H15ClN4O2 — CID 80777905
methyl 2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]acetate (PubChem CID 80777905) has the molecular formula C10H15ClN4O2 and a molecular weight of 258.71 g/mol. Its IUPAC name is methyl 2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]acetate.
| Compound Name | methyl 2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 80777905 |
| Molecular Formula | C10H15ClN4O2 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | methyl 2-[[5-chloro-2-(propylamino)pyrimidin-4-yl]amino]acetate |
| SMILES | CCCNc1ncc(Cl)c(NCC(=O)OC)n1 |
| InChI | InChI=1S/C10H15ClN4O2/c1-3-4-12-10-14-5-7(11)9(15-10)13-6-8(16)17-2/h5H,3-4,6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | BXBYNMJTTTZMEV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |