C14H23N3O2 — CID 83120713
3-[2-[(2-hydroxy-2-phenylpropyl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83120713) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[2-[(2-hydroxy-2-phenylpropyl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2-hydroxy-2-phenylpropyl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83120713 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-[2-[(2-hydroxy-2-phenylpropyl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C14H23N3O2/c1-14(19,12-7-5-4-6-8-12)11-15-9-10-16-13(18)17(2)3/h4-8,15,19H,9-11H2,1-3H3,(H,16,18) |
| InChIKey | GLKAZWHHPSGMPG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|