C24H26N2O2 — CID 134836754
3-[2-[3-[hydroxy(diphenyl)methyl]phenyl]ethyl]-1,1-dimethylurea (PubChem CID 134836754) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[2-[3-[hydroxy(diphenyl)methyl]phenyl]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[3-[hydroxy(diphenyl)methyl]phenyl]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 134836754 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-[2-[3-[hydroxy(diphenyl)methyl]phenyl]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCc1cccc(C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-26(2)23(27)25-17-16-19-10-9-15-22(18-19)24(28,20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-15,18,28H,16-17H2,1-2H3,(H,25,27) |
| InChIKey | UNOLXWFWEWBZHC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|