C13H17N3O4 — CID 83115246
3-[2-(dimethylcarbamoylamino)ethylcarbamoyl]benzoic acid (PubChem CID 83115246) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[2-(dimethylcarbamoylamino)ethylcarbamoyl]benzoic acid.
| Compound Name | 3-[2-(dimethylcarbamoylamino)ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 83115246 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[2-(dimethylcarbamoylamino)ethylcarbamoyl]benzoic acid |
| SMILES | CN(C)C(=O)NCCNC(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H17N3O4/c1-16(2)13(20)15-7-6-14-11(17)9-4-3-5-10(8-9)12(18)19/h3-5,8H,6-7H2,1-2H3,(H,14,17)(H,15,20)(H,18,19) |
| InChIKey | UDLIIMJWZDLENW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|