C12H14BrFN4O — CID 107533953
3-[2-(3-bromo-4-cyano-2-fluoroanilino)ethyl]-1,1-dimethylurea (PubChem CID 107533953) has the molecular formula C12H14BrFN4O and a molecular weight of 329.17 g/mol. Its IUPAC name is 3-[2-(3-bromo-4-cyano-2-fluoroanilino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(3-bromo-4-cyano-2-fluoroanilino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 107533953 |
| Molecular Formula | C12H14BrFN4O |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 3-[2-(3-bromo-4-cyano-2-fluoroanilino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccc(C#N)c(Br)c1F |
| InChI | InChI=1S/C12H14BrFN4O/c1-18(2)12(19)17-6-5-16-9-4-3-8(7-15)10(13)11(9)14/h3-4,16H,5-6H2,1-2H3,(H,17,19) |
| InChIKey | BTUMENSPAIBJLY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|